ChemNet > CAS > 816-40-0 1-bromo-2-butanone
816-40-0 1-bromo-2-butanone
| product Name |
1-bromo-2-butanone |
| CAS No |
816-40-0 |
| Synonyms |
Bromomethyl ethyl ketone; 1-bromobutan-2-one |
| Molecular Formula |
C4H7BrO |
| Molecular Weight |
151.0018 |
| InChI |
InChI=1/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 |
| EINECS |
212-431-3 |
| Molecular Structure |
|
| Density |
1.439g/cm3 |
| Boiling point |
155.9°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
68.3°C |
| Vapour Pressur |
2.96mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
