ChemNet > CAS > 81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
| product Name |
ethyl 2-amino-4-methylpyrimidine-5-carboxylate |
| Molecular Formula |
C8H11N3O2 |
| Molecular Weight |
181.1918 |
| InChI |
InChI=1/C8H11N3O2/c1-3-13-7(12)6-4-10-8(9)11-5(6)2/h4H,3H2,1-2H3,(H2,9,10,11) |
| CAS Registry Number |
81633-29-6 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Melting point |
220℃ |
| Boiling point |
350.5°C at 760 mmHg |
| Refractive index |
1.556 |
| Flash point |
165.8°C |
| Vapour Pressur |
4.38E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
ethyl 2-amino-4-methylpyrimidine-5-carboxylate Material Safety Data Sheet
|
|
