ChemNet > CAS > 82-05-3 Benzanthrone
82-05-3 Benzanthrone
| product Name |
Benzanthrone |
| Synonyms |
7H-Benz[de]anthracen-7-one; Benzanthrone,98%; benz(d e)anthracen-7-one; 7H-benzo[de]anthracen-7-one |
| Molecular Formula |
C17H10O |
| Molecular Weight |
230.2607 |
| InChI |
InChI=1/C17H10O/c18-17-14-8-2-1-7-12(14)13-9-3-5-11-6-4-10-15(17)16(11)13/h1-10H |
| CAS Registry Number |
82-05-3 |
| EINECS |
201-393-3 |
| Molecular Structure |
|
| Density |
1.286g/cm3 |
| Melting point |
170℃ |
| Boiling point |
436.2°C at 760 mmHg |
| Refractive index |
1.734 |
| Flash point |
196.1°C |
| Vapour Pressur |
8.27E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Benzanthrone Material Safety Data Sheet
|
|
