82-22-4 1,1'-dianthrimide
| product Name |
1,1'-dianthrimide |
| CAS No |
82-22-4 |
| Synonyms |
1,1-iminodianthraquinone; 1,1'-iminodianthracene-9,10-dione |
| Molecular Formula |
C28H15NO4 |
| Molecular Weight |
429.423 |
| InChI |
InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
| EINECS |
201-405-7 |
| Molecular Structure |
|
| Density |
1.456g/cm3 |
| Melting point |
300℃ |
| Boiling point |
667.1°C at 760 mmHg |
| Refractive index |
1.753 |
| Flash point |
221.6°C |
| Vapour Pressur |
1.17E-17mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|