ChemNet > CAS > 82-46-2 1,5-Dichloroanthraquinone
82-46-2 1,5-Dichloroanthraquinone
product Name |
1,5-Dichloroanthraquinone |
Synonyms |
1,5-Dichloranthrachinon; 1,5-Dichloranthrachinon [Czech]; 1,5-Dichloro-9,10-anthraquinone; 9,10-Anthracenedione, 1,5-dichloro-; AI3-38301; NSC 13969; Anthraquinone, 1,5-dichloro-; 1,5-dichloroanthracene-9,10-dione; 1,5-Dichloro Anthraquinone |
Molecular Formula |
C14H6Cl2O2 |
Molecular Weight |
277.1022 |
InChI |
InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
CAS Registry Number |
82-46-2 |
EINECS |
201-424-0 |
Molecular Structure |
|
Density |
1.514g/cm3 |
Melting point |
245-250℃ |
Boiling point |
455.2°C at 760 mmHg |
Refractive index |
1.671 |
Flash point |
191.7°C |
Vapour Pressur |
1.79E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|