ChemNet > CAS > 82191-17-1 ethyl 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate
82191-17-1 ethyl 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate
| product Name |
ethyl 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate |
| CAS No |
82191-17-1 |
| Synonyms |
ethyl (3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate |
| Molecular Formula |
C12H13NO3S |
| Molecular Weight |
251.3015 |
| InChI |
InChI=1/C12H13NO3S/c1-2-16-11(14)7-10-12(15)13-8-5-3-4-6-9(8)17-10/h3-6,10H,2,7H2,1H3,(H,13,15) |
| Molecular Structure |
|
| Density |
1.241g/cm3 |
| Melting point |
126℃ |
| Boiling point |
419°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
207.2°C |
| Vapour Pressur |
3.13E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
