ChemNet > CAS > 82374-34-3 Bis-(2-ethylhexyl)-sulfoxide
82374-34-3 Bis-(2-ethylhexyl)-sulfoxide
| product Name |
Bis-(2-ethylhexyl)-sulfoxide |
| CAS No |
82374-34-3 |
| Synonyms |
Bis(2-ethylhexyl)sulfoxide; Bis(2-ethylhexyl) sulphoxide; 3,3'-(sulfinyldimethanediyl)diheptane |
| Molecular Formula |
C16H34OS |
| Molecular Weight |
274.5056 |
| InChI |
InChI=1/C16H34OS/c1-5-9-11-15(7-3)13-18(17)14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3 |
| Molecular Structure |
|
| Density |
0.906g/cm3 |
| Boiling point |
390.6°C at 760 mmHg |
| Refractive index |
1.472 |
| Flash point |
190°C |
| Vapour Pressur |
5.9E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
