ChemNet > CAS > 825-51-4 Decahydro-2-naphthol, mixture of isomers
825-51-4 Decahydro-2-naphthol, mixture of isomers
| product Name |
Decahydro-2-naphthol, mixture of isomers |
| CAS No |
825-51-4 |
| Synonyms |
Decahydro-2-naphthol; decahydronaphthalen-2-ol; (2R,4aR,8aR)-decahydronaphthalen-2-ol; (2R,4aS,8aS)-decahydronaphthalen-2-ol; (2S,4aS,8aS)-decahydronaphthalen-2-ol; (2R,4aS,8aR)-decahydronaphthalen-2-ol; (2S,4aS,8aR)-decahydronaphthalen-2-ol |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.2493 |
| InChI |
InChI=1/C10H18O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-11H,1-7H2/t8-,9+,10-/m0/s1 |
| EINECS |
212-545-3 |
| Molecular Structure |
|
| Density |
0.993g/cm3 |
| Boiling point |
211.594°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
102.148°C |
| Vapour Pressur |
0.041mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
