ChemNet > CAS > 827-15-6 iodopentafluorobenzene
827-15-6 iodopentafluorobenzene
| product Name |
iodopentafluorobenzene |
| CAS No |
827-15-6 |
| Synonyms |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene; 1-Iodo-2,3,4,5,6-Pentafluorobenzene |
| Molecular Formula |
C6F5I |
| Molecular Weight |
293.9607 |
| InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| EINECS |
212-565-2 |
| Molecular Structure |
|
| Density |
2.217g/cm3 |
| Boiling point |
166.7°C at 760 mmHg |
| Refractive index |
1.502 |
| Flash point |
61.3°C |
| Vapour Pressur |
2.33mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
