ChemNet > CAS > 83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
| product Name |
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
| CAS No |
83-18-1 |
| Synonyms |
1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-; NSC 68230; 2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde; Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde; 2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
| Molecular Formula |
C13H19NO |
| Molecular Weight |
205.2961 |
| InChI |
InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
| EINECS |
201-458-6 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Boiling point |
345.8°C at 760 mmHg |
| Refractive index |
1.559 |
| Flash point |
163°C |
| Vapour Pressur |
6E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
