83-27-2 Diethyl sec-Butylmalonate
product Name |
Diethyl sec-Butylmalonate |
CAS No |
83-27-2 |
Synonyms |
Butylmalonicaciddiethylester; sec-Butylmalonic acid diethyl ester; diethyl butan-2-ylpropanedioate; diethyl [(1S)-1-methylpropyl]propanedioate; diethyl [(1R)-1-methylpropyl]propanedioate |
Molecular Formula |
C11H20O4 |
Molecular Weight |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
EINECS |
201-463-3 |
Molecular Structure |
|
Density |
0.992g/cm3 |
Boiling point |
247.5°C at 760 mmHg |
Refractive index |
1.431 |
Flash point |
103.1°C |
Vapour Pressur |
0.0256mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|