ChemNet > CAS > 830-03-5 4-Nitrophenyl acetate
830-03-5 4-Nitrophenyl acetate
| product Name |
4-Nitrophenyl acetate |
| Synonyms |
Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
| Molecular Formula |
C8H7NO4 |
| Molecular Weight |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| CAS Registry Number |
830-03-5 |
| EINECS |
212-593-5 |
| Molecular Structure |
|
| Density |
1.304g/cm3 |
| Melting point |
76-79℃ |
| Boiling point |
296.8°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
145.2°C |
| Vapour Pressur |
0.0014mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
4-Nitrophenyl acetate Material Safety Data Sheet
|
|
