ChemNet > CAS > 831-91-4 Benzyl phenyl sulfide
831-91-4 Benzyl phenyl sulfide
| product Name |
Benzyl phenyl sulfide |
| Synonyms |
Benzyl phenyl sulphide; Benzyl phenyl sylphide; (benzylsulfanyl)benzene |
| Molecular Formula |
C13H12S |
| Molecular Weight |
200.2994 |
| InChI |
InChI=1/C13H12S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
| CAS Registry Number |
831-91-4 |
| EINECS |
212-612-7 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Melting point |
40-43℃ |
| Boiling point |
321.1°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
138.9°C |
| Vapour Pressur |
0.000572mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Benzyl phenyl sulfide Material Safety Data Sheet
|
|
