ChemNet > CAS > 83463-62-1 Bromochloroacetonitrile
83463-62-1 Bromochloroacetonitrile
| product Name |
Bromochloroacetonitrile |
| CAS No |
83463-62-1 |
| Synonyms |
Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
| Molecular Formula |
C2HBrClN |
| Molecular Weight |
154.393 |
| InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
| Molecular Structure |
|
| Density |
1.932g/cm3 |
| Boiling point |
121.1°C at 760 mmHg |
| Refractive index |
1.506 |
| Flash point |
27.1°C |
| Vapour Pressur |
14.8mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
