ChemNet > CAS > 838-57-3 Ethyl 4-nitrobenzoylacetate
838-57-3 Ethyl 4-nitrobenzoylacetate
| product Name |
Ethyl 4-nitrobenzoylacetate |
| CAS No |
838-57-3 |
| Synonyms |
Ethyl (p-nitrobenzoyl)acetate; (4-Nitrobenzoyl)acetic acid ethyl ester; (p-Nitrobenzoyl)acetic acid ethyl ester; 4-10-00-02759 (Beilstein Handbook Reference); Acetic acid, (p-nitrobenzoyl)-, ethyl ester; BRN 1124763; Ethyl (4-nitrobenzoyl)acetate; Ethyl 4-nitro-beta-oxobenzenepropanoate; NSC 62134; Benzenepropanoic acid, 4-nitro-beta-oxo-, ethyl ester; ethyl 3-(4-nitrophenyl)-3-oxopropanoate |
| Molecular Formula |
C11H11NO5 |
| Molecular Weight |
237.2087 |
| InChI |
InChI=1/C11H11NO5/c1-2-17-11(14)7-10(13)8-3-5-9(6-4-8)12(15)16/h3-6H,2,7H2,1H3 |
| EINECS |
212-656-7 |
| Molecular Structure |
|
| Density |
1.276g/cm3 |
| Melting point |
67-71℃ |
| Boiling point |
344.7°C at 760 mmHg |
| Refractive index |
1.542 |
| Flash point |
149.6°C |
| Vapour Pressur |
6.49E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
