ChemNet > CAS > 84-85-5 4-Methoxy-1-naphthol
84-85-5 4-Methoxy-1-naphthol
| product Name |
4-Methoxy-1-naphthol |
| CAS No |
84-85-5 |
| Synonyms |
1-Hydroxy-4-methoxynaphthalene; 4-methoxynaphthalen-1-ol |
| Molecular Formula |
C11H10O2 |
| Molecular Weight |
174.1959 |
| InChI |
InChI=1/C11H10O2/c1-13-11-7-6-10(12)8-4-2-3-5-9(8)11/h2-7,12H,1H3 |
| EINECS |
201-566-3 |
| Molecular Structure |
|
| Density |
1.193g/cm3 |
| Melting point |
128-130℃ |
| Boiling point |
350.1°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
228.6°C |
| Vapour Pressur |
2.23E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
