ChemNet > CAS > 840-65-3 dimethyl naphthalene-2,6-dicarboxylate
840-65-3 dimethyl naphthalene-2,6-dicarboxylate
| product Name |
dimethyl naphthalene-2,6-dicarboxylate |
| CAS No |
840-65-3 |
| Synonyms |
Naphthalene-2,6-dicarboxylic acid dimethyl ester; Dimethyl-2,6-naphthalene dicaboxylate; 2,6-DMN; Dimethyl 2,6-Naphthalenedicarboxylate |
| Molecular Formula |
C14H12O4 |
| Molecular Weight |
244.2427 |
| InChI |
InChI=1/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 |
| EINECS |
212-661-4 |
| Molecular Structure |
|
| Density |
1.225g/cm3 |
| Melting point |
187-190℃ |
| Boiling point |
375.3°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
189.2°C |
| Vapour Pressur |
7.88E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
