ChemNet > CAS > 84006-10-0 2-Chloromethyl-3,5-dimethyl-4-methoxypyridine
84006-10-0 2-Chloromethyl-3,5-dimethyl-4-methoxypyridine
| product Name |
2-Chloromethyl-3,5-dimethyl-4-methoxypyridine |
| CAS No |
84006-10-0 |
| Synonyms |
2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine; 2-(Chloromethyl)-3,5-dimethyl-4-methoxypyridine; 2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine hydrochloride (1:1) |
| Molecular Formula |
C9H13Cl2NO |
| Molecular Weight |
222.1116 |
| InChI |
InChI=1/C9H12ClNO.ClH/c1-6-5-11-8(4-10)7(2)9(6)12-3;/h5H,4H2,1-3H3;1H |
| Molecular Structure |
|
| Boiling point |
272.2°C at 760 mmHg |
| Flash point |
118.4°C |
| Vapour Pressur |
0.0103mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
