ChemNet > CAS > 84211-94-9 4-(Ethylthio)benzaldehyde
84211-94-9 4-(Ethylthio)benzaldehyde
| product Name |
4-(Ethylthio)benzaldehyde |
| CAS No |
84211-94-9 |
| Synonyms |
4-(ethylsulfanyl)benzaldehyde |
| Molecular Formula |
C9H10OS |
| Molecular Weight |
166.2401 |
| InChI |
InChI=1/C9H10OS/c1-2-11-9-5-3-8(7-10)4-6-9/h3-7H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Boiling point |
281.6°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
139.9°C |
| Vapour Pressur |
0.00353mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
