ChemNet > CAS > 844-51-9 2,5-Diphenyl-p-benzoquinone
844-51-9 2,5-Diphenyl-p-benzoquinone
| product Name |
2,5-Diphenyl-p-benzoquinone |
| CAS No |
844-51-9 |
| Synonyms |
2,5-Diphenyl-4-benzoquinone; 2,5-Diphenyl-1,4-benzoquinone; AI3-61046; NSC 8725; 2,5-Cyclohexadiene-1,4-dione, 2,5-diphenyl-; p-Benzoquinone, 2,5-diphenyl- (8CI); 2,5-diphenylcyclohexa-2,5-diene-1,4-dione |
| Molecular Formula |
C18H12O2 |
| Molecular Weight |
260.2867 |
| InChI |
InChI=1/C18H12O2/c19-17-12-16(14-9-5-2-6-10-14)18(20)11-15(17)13-7-3-1-4-8-13/h1-12H |
| EINECS |
212-680-8 |
| Molecular Structure |
|
| Density |
1.237g/cm3 |
| Boiling point |
457.9°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
170.5°C |
| Vapour Pressur |
1.43E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
