ChemNet > CAS > 84544-86-5 2-(phenylthio)ethanimidamide hydrochloride
84544-86-5 2-(phenylthio)ethanimidamide hydrochloride
| product Name |
2-(phenylthio)ethanimidamide hydrochloride |
| Synonyms |
2-(Phenylthio)acetamidine hydrochloride; (1Z)-2-(phenylsulfanyl)ethanimidamide hydrochloride; 1-amino-2-(phenylsulfanyl)ethaniminium |
| Molecular Formula |
C8H11N2S |
| Molecular Weight |
167.2508 |
| InChI |
InChI=1/C8H10N2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10)/p+1 |
| CAS Registry Number |
84544-86-5 |
| Molecular Structure |
|
| Melting point |
175℃ |
| Boiling point |
276.3°C at 760 mmHg |
| Flash point |
120.9°C |
| Vapour Pressur |
0.00485mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
2-(phenylthio)ethanimidamide hydrochloride Material Safety Data Sheet
|
|
