ChemNet > CAS > 84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
| product Name |
4-Dimethylamino-2-methoxybenzaldehyde |
| CAS No |
84562-48-1 |
| Molecular Formula |
C10H13NO2 |
| Molecular Weight |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3 |
| Molecular Structure |
|
| Density |
1.098g/cm3 |
| Melting point |
59-60℃ |
| Boiling point |
305.9°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
138.8°C |
| Vapour Pressur |
0.000796mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
