ChemNet > CAS > 85408-26-0 1-Propene, 2-methyl-, reaction products with sulfur chloride (S2Cl2)
85408-26-0 1-Propene, 2-methyl-, reaction products with sulfur chloride (S2Cl2)
| product Name |
1-Propene, 2-methyl-, reaction products with sulfur chloride (S2Cl2) |
| CAS No |
85408-26-0 |
| Synonyms |
Reaction product of sulfur monochloride with isobutylene; chlorosulfanyl thiohypochlorite; 2-methylprop-1-ene |
| Molecular Formula |
C4H8Cl2S2 |
| Molecular Weight |
191.1423 |
| InChI |
InChI=1/C4H8.Cl2S2/c1-4(2)3;1-3-4-2/h1H2,2-3H3; |
| EINECS |
286-986-5 |
| Molecular Structure |
|
| Vapour Pressur |
2140mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
