ChemNet > CAS > 85712-05-6 2,5-dimethylheptan-1-ol
85712-05-6 2,5-dimethylheptan-1-ol
| product Name |
2,5-dimethylheptan-1-ol |
| CAS No |
85712-05-6 |
| Synonyms |
2,5-Dimethylheptan-1-ol |
| Molecular Formula |
C9H20O |
| Molecular Weight |
144.2545 |
| InChI |
InChI=1/C9H20O/c1-4-8(2)5-6-9(3)7-10/h8-10H,4-7H2,1-3H3 |
| EINECS |
288-363-3 |
| Molecular Structure |
|
| Density |
0.822g/cm3 |
| Boiling point |
189.1°C at 760 mmHg |
| Refractive index |
1.428 |
| Flash point |
76.3°C |
| Vapour Pressur |
0.158mmHg at 25°C |
|