ChemNet > CAS > 86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
| product Name |
5-nitro-1-benzothiophene-2-carbonyl chloride |
| CAS No |
86010-32-4 |
| Molecular Formula |
C9H4ClNO3S |
| Molecular Weight |
241.651 |
| InChI |
InChI=1/C9H4ClNO3S/c10-9(12)8-4-5-3-6(11(13)14)1-2-7(5)15-8/h1-4H |
| Molecular Structure |
|
| Density |
1.597g/cm3 |
| Melting point |
158℃ |
| Boiling point |
401.7°C at 760 mmHg |
| Refractive index |
1.712 |
| Flash point |
196.7°C |
| Vapour Pressur |
1.16E-06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
