ChemNet > CAS > 86454-13-9 2-hydroxy-6-methylisonicotinic acid
86454-13-9 2-hydroxy-6-methylisonicotinic acid
| product Name |
2-hydroxy-6-methylisonicotinic acid |
| CAS No |
86454-13-9 |
| Synonyms |
6-methyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid; 2-Hydroxy-6-Methylpyridine-4-Carboxylic Acid |
| Molecular Formula |
C7H7NO3 |
| Molecular Weight |
153.1354 |
| InChI |
InChI=1/C7H7NO3/c1-4-2-5(7(10)11)3-6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11) |
| Molecular Structure |
|
| Density |
1.345g/cm3 |
| Melting point |
330℃ |
| Boiling point |
371.2°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
178.3°C |
| Vapour Pressur |
1.57E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
