87-05-8 7-Ethoxy-4-methylcoumarin
product Name |
7-Ethoxy-4-methylcoumarin |
CAS No |
87-05-8 |
Synonyms |
7-Ethoxy-4-methyl-2H-chromen-2-one; Ethyl 4-methylumbelliferyl ether |
Molecular Formula |
C12H12O3 |
Molecular Weight |
204.2219 |
InChI |
InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
EINECS |
201-721-5 |
Molecular Structure |
|
Density |
1.163g/cm3 |
Melting point |
113-114℃ |
Boiling point |
351.4°C at 760 mmHg |
Refractive index |
1.548 |
Flash point |
146.2°C |
Vapour Pressur |
4.12E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|