ChemNet > CAS > 87-29-6 cinnamyl anthranilate
87-29-6 cinnamyl anthranilate
| product Name |
cinnamyl anthranilate |
| CAS No |
87-29-6 |
| Synonyms |
2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate; 3-phenylprop-2-en-1-yl 2-aminobenzoate; (2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
| Molecular Formula |
C16H15NO2 |
| Molecular Weight |
253.2958 |
| InChI |
InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
| EINECS |
201-738-8 |
| Molecular Structure |
|
| Density |
1.178g/cm3 |
| Boiling point |
449.1°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
269.4°C |
| Vapour Pressur |
2.95E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
