ChemNet > CAS > 87-64-9 2-Chloro-6-methylphenol
87-64-9 2-Chloro-6-methylphenol
| product Name |
2-Chloro-6-methylphenol |
| CAS No |
87-64-9 |
| Synonyms |
2-Chloro-6-methylphenol,98%; 6-Chloro-o-cresol (OH=1); 6-Chloro-o-cresol |
| Molecular Formula |
C7H7ClO |
| Molecular Weight |
142.5829 |
| InChI |
InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
| EINECS |
201-760-8 |
| Molecular Structure |
|
| Density |
1.228g/cm3 |
| Boiling point |
200.4°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
75°C |
| Vapour Pressur |
0.229mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
