ChemNet > CAS > 87-85-4 Hexamethylbenzene
87-85-4 Hexamethylbenzene
| product Name |
Hexamethylbenzene |
| CAS No |
87-85-4 |
| Synonyms |
Mellitene |
| Molecular Formula |
C12H18 |
| Molecular Weight |
162.2713 |
| InChI |
InChI=1/C12H18/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3 |
| EINECS |
201-777-0 |
| Molecular Structure |
|
| Density |
0.867g/cm3 |
| Melting point |
165-168℃ |
| Boiling point |
256.6°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
104.3°C |
| Vapour Pressur |
0.0245mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
