ChemNet > CAS > 87223-76-5 ethyl 2-(2-cyanoanilino)acetate
87223-76-5 ethyl 2-(2-cyanoanilino)acetate
| product Name |
ethyl 2-(2-cyanoanilino)acetate |
| CAS No |
87223-76-5 |
| Synonyms |
ethyl N-(2-cyanophenyl)glycinate |
| Molecular Formula |
C11H12N2O2 |
| Molecular Weight |
204.2252 |
| InChI |
InChI=1/C11H12N2O2/c1-2-15-11(14)8-13-10-6-4-3-5-9(10)7-12/h3-6,13H,2,8H2,1H3 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
351.1°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
166.1°C |
| Vapour Pressur |
4.2E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
