ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
| product Name |
2-Chloro-6-fluoroacetophenone |
| CAS No |
87327-69-3 |
| Synonyms |
1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
| Molecular Formula |
C8H6ClFO |
| Molecular Weight |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.258g/cm3 |
| Boiling point |
191.8°C at 760 mmHg |
| Refractive index |
1.512 |
| Flash point |
69.8°C |
| Vapour Pressur |
0.506mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
