ChemNet > CAS > 877-43-0 2,6-Dimethylquinoline
877-43-0 2,6-Dimethylquinoline
| product Name |
2,6-Dimethylquinoline |
| CAS No |
877-43-0 |
| Synonyms |
6-METHYLQUINALDINE; 2,6-dimethyl-quinolin; P-TOLUQUINALDINE; Quinoline, 2,6-dimethyl- |
| Molecular Formula |
C11H11N |
| Molecular Weight |
157.2117 |
| InChI |
InChI=1/C11H11N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3-7H,1-2H3 |
| EINECS |
212-891-5 |
| Molecular Structure |
|
| Density |
1.052g/cm3 |
| Melting point |
56-60 °C |
| Boiling point |
266.5°C at 760 mmHg |
| Refractive index |
1.61 |
| Flash point |
106.5°C |
| Vapour Pressur |
0.0142mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
