ChemNet > CAS > 88-96-0 Phthalamide
88-96-0 Phthalamide
| product Name |
Phthalamide |
| Synonyms |
1,2-Benzenedicarboxamide; 4-09-00-03265 (Beilstein Handbook Reference); AI3-03746; BRN 1868220; CCRIS 518; HSDB 4087; NCI-C03612; NSC 5512; P-D; Phthaldiamide; Phthalic acid diamide; o-Carbamoylbenzamide; o-Phthalic acid diamide; benzene-1,2-dicarboxamide |
| Molecular Formula |
C8H8N2O2 |
| Molecular Weight |
164.1613 |
| InChI |
InChI=1/C8H8N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,(H2,9,11)(H2,10,12) |
| CAS Registry Number |
88-96-0 |
| EINECS |
201-870-6 |
| Molecular Structure |
|
| Density |
1.294g/cm3 |
| Boiling point |
430.8°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
214.4°C |
| Vapour Pressur |
1.26E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
