ChemNet > CAS > 881-03-8 2-Methyl-1-nitronaphthalene
881-03-8 2-Methyl-1-nitronaphthalene
| product Name |
2-Methyl-1-nitronaphthalene |
| CAS No |
881-03-8 |
| Synonyms |
Naphthalene, 2-methyl-1-nitro-; 1-Nitro-2-methylnaphthalene; 4-05-00-01698 (Beilstein Handbook Reference); BRN 1954310; CCRIS 4680; NSC 7516 |
| Molecular Formula |
C11H9NO2 |
| Molecular Weight |
187.1947 |
| InChI |
InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| EINECS |
212-917-5 |
| Molecular Structure |
|
| Density |
1.234g/cm3 |
| Melting point |
79-82℃ |
| Boiling point |
320.5°C at 760 mmHg |
| Refractive index |
1.652 |
| Flash point |
150.4°C |
| Vapour Pressur |
0.000594mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
