ChemNet > CAS > 881-68-5 acetyl vanillin
881-68-5 acetyl vanillin
| product Name |
acetyl vanillin |
| CAS No |
881-68-5 |
| Synonyms |
Vanillin acetate; 4-formyl-2-methoxyphenyl acetate; 4-Acetoxy-3-methoxybenzaidehyde; o-Acetylvanillin; 4-Acetoxy-3-methoxybenzaldehyde |
| Molecular Formula |
C10H10O4 |
| Molecular Weight |
194.184 |
| InChI |
InChI=1/C10H10O4/c1-6(12)9-7(5-11)3-4-8(13)10(9)14-2/h3-5,13H,1-2H3 |
| EINECS |
212-920-1 |
| Molecular Structure |
|
| Melting point |
77-79℃ |
| Refractive index |
1.579 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
