ChemNet > CAS > 88196-70-7 (R)-1-(3-Methoxyphenyl)ethylamine
88196-70-7 (R)-1-(3-Methoxyphenyl)ethylamine
| product Name |
(R)-1-(3-Methoxyphenyl)ethylamine |
| CAS No |
88196-70-7 |
| Synonyms |
(R)-m-Methoxy-alpha-methylbenzylamine; (1R)-1-(3-methoxyphenyl)ethanamine |
| Molecular Formula |
C9H13NO |
| Molecular Weight |
151.2056 |
| InChI |
InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m1/s1 |
| Molecular Structure |
|
| Density |
1.003g/cm3 |
| Boiling point |
234.6°C at 760 mmHg |
| Refractive index |
1.522 |
| Flash point |
94.7°C |
| Vapour Pressur |
0.0524mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
