ChemNet > CAS > 886-38-4 Diphenylcyclopropenone
886-38-4 Diphenylcyclopropenone
| product Name |
Diphenylcyclopropenone |
| CAS No |
886-38-4 |
| Synonyms |
Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
| Molecular Formula |
C15H10O |
| Molecular Weight |
206.2393 |
| InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| EINECS |
212-948-4 |
| Molecular Structure |
|
| Density |
1.232g/cm3 |
| Melting point |
119-121℃ |
| Boiling point |
407.2°C at 760 mmHg |
| Refractive index |
1.668 |
| Flash point |
182.7°C |
| Vapour Pressur |
7.66E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R43:May cause sensitization by skin contact.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
