ChemNet > CAS > 886-65-7 trans,trans-1,4-Diphenyl-1,3-butadiene
886-65-7 trans,trans-1,4-Diphenyl-1,3-butadiene
| product Name |
trans,trans-1,4-Diphenyl-1,3-butadiene |
| CAS No |
886-65-7 |
| Synonyms |
DPB; 1,4-Diphenyl-1,3-butadiene; bistyryl; 1,1'-(1Z,3Z)-buta-1,3-diene-1,4-diyldibenzene |
| Molecular Formula |
C16H14 |
| Molecular Weight |
206.2824 |
| InChI |
InChI=1/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7-,14-8- |
| EINECS |
212-952-6 |
| Molecular Structure |
|
| Density |
1.035g/cm3 |
| Melting point |
151-154℃ |
| Boiling point |
367°C at 760 mmHg |
| Refractive index |
1.653 |
| Flash point |
190°C |
| Vapour Pressur |
2.97E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
