ChemNet > CAS > 886-66-8 1,4-Diphenylbutadiyne
886-66-8 1,4-Diphenylbutadiyne
| product Name |
1,4-Diphenylbutadiyne |
| CAS No |
886-66-8 |
| Molecular Formula |
C16H10 |
| Molecular Weight |
202.2506 |
| InChI |
InChI=1/C16H10/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H |
| EINECS |
212-953-1 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Melting point |
85-88℃ |
| Boiling point |
338.2°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
150.5°C |
| Vapour Pressur |
0.000196mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
