ChemNet > CAS > 88634-80-4 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde
88634-80-4 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde
| product Name |
2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde |
| CAS No |
88634-80-4 |
| Synonyms |
2-ethyl-5-methyl-1H-imidazole-4-carbaldehyde |
| Molecular Formula |
C7H10N2O |
| Molecular Weight |
138.1671 |
| InChI |
InChI=1/C7H10N2O/c1-3-7-8-5(2)6(4-10)9-7/h4H,3H2,1-2H3,(H,8,9) |
| Molecular Structure |
|
| Density |
1.134g/cm3 |
| Melting point |
104℃ |
| Boiling point |
360.8°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
175.8°C |
| Vapour Pressur |
2.16E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
