ChemNet > CAS > 89-35-0 3,5-Dihydroxy-2-naphthalenecarboxylic acid
89-35-0 3,5-Dihydroxy-2-naphthalenecarboxylic acid
product Name |
3,5-Dihydroxy-2-naphthalenecarboxylic acid |
Synonyms |
3,5-Dihydroxy-2-naphthoic acid; 3,5-dihydroxynaphthalene-2-carboxylic acid; 3,5-dihydroxynaphthalene-2-carboxylate |
Molecular Formula |
C11H7O4 |
Molecular Weight |
203.1714 |
InChI |
InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1 |
CAS Registry Number |
89-35-0 |
EINECS |
201-900-8 |
Molecular Structure |
|
Melting point |
275-280℃ |
Boiling point |
442.2°C at 760 mmHg |
Flash point |
235.3°C |
Vapour Pressur |
1.35E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|