ChemNet > CAS > 89250-34-0 3-(2-methyl-1,3-thiazol-4-yl)aniline
89250-34-0 3-(2-methyl-1,3-thiazol-4-yl)aniline
| product Name |
3-(2-methyl-1,3-thiazol-4-yl)aniline |
| CAS No |
89250-34-0 |
| Molecular Formula |
C10H10N2S |
| Molecular Weight |
190.2648 |
| InChI |
InChI=1/C10H10N2S/c1-7-12-10(6-13-7)8-3-2-4-9(11)5-8/h2-6H,11H2,1H3 |
| Molecular Structure |
|
| Density |
1.219g/cm3 |
| Boiling point |
380.6°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
184°C |
| Vapour Pressur |
5.37E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
