ChemNet > CAS > 89466-08-0 2-Hydroxybenzeneboronic acid
89466-08-0 2-Hydroxybenzeneboronic acid
| product Name |
2-Hydroxybenzeneboronic acid |
| CAS No |
89466-08-0 |
| Synonyms |
2-Boronophenol; 2-Hydroxyphenylboronic acid |
| Molecular Formula |
C6H7BO3 |
| Molecular Weight |
137.929 |
| InChI |
InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Boiling point |
327.3°C at 760 mmHg |
| Refractive index |
1.582 |
| Flash point |
151.7°C |
| Vapour Pressur |
8.28E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
