ChemNet > CAS > 89479-66-3 3-methyl-5-phenyl-4-isoxazolecarbaldehyde
89479-66-3 3-methyl-5-phenyl-4-isoxazolecarbaldehyde
| product Name |
3-methyl-5-phenyl-4-isoxazolecarbaldehyde |
| CAS No |
89479-66-3 |
| Synonyms |
3-methyl-5-phenylisoxazole-4-carbaldehyde |
| Molecular Formula |
C11H9NO2 |
| Molecular Weight |
187.1947 |
| InChI |
InChI=1/C11H9NO2/c1-8-10(7-13)11(14-12-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| Molecular Structure |
|
| Density |
1.179g/cm3 |
| Melting point |
89℃ |
| Boiling point |
357.2°C at 760 mmHg |
| Refractive index |
1.58 |
| Flash point |
169.8°C |
| Vapour Pressur |
2.78E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
