ChemNet > CAS > 89560-81-6 oleic acid, compound with tributylamine (1:1)
89560-81-6 oleic acid, compound with tributylamine (1:1)
| product Name |
oleic acid, compound with tributylamine (1:1) |
| CAS No |
89560-81-6 |
| Synonyms |
Oleic acid, compound with tributylamine (1:1); N,N-dibutylbutan-1-amine; (Z)-octadec-9-enoic acid |
| Molecular Formula |
C30H61NO2 |
| Molecular Weight |
467.8108 |
| InChI |
InChI=1/C18H34O2.C12H27N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-7-10-13(11-8-5-2)12-9-6-3/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-12H2,1-3H3/b10-9-; |
| EINECS |
289-507-8 |
| Molecular Structure |
|
| Boiling point |
538.2°C at 760 mmHg |
| Flash point |
279.3°C |
| Vapour Pressur |
5.17E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
