ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
| product Name |
poly(chlorotrifluoroethylene) |
| CAS No |
9002-83-9 |
| Synonyms |
halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
| Molecular Formula |
C2ClF3 |
| Molecular Weight |
116.4693 |
| InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
| Molecular Structure |
|
| Density |
1.9 |
| Melting point |
210℃ |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
