ChemNet > CAS > 9003-20-7 Poly(vinyl acetate)
9003-20-7 Poly(vinyl acetate)
| product Name |
Poly(vinyl acetate) |
| Synonyms |
PolyvinylacetateMWca; poly(1-acetoxyethylene); Vinyl Acetate Resin (Low M.Wt.); Vinyl Acetate Latex (Med.Particle Size); Vinyl Acetate Latex (Large Particle Size); Vinyl Acetate Resin (Med.M.Wt.); Vinyl Acetate Resin(High M.Wt.); Polyvinyl Acetate; methyl prop-2-enoate; Polymer vinyl acetate; PVAC |
| Molecular Formula |
C4H6O2 |
| Molecular Weight |
86.0892 |
| InChI |
InChI=1/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 |
| CAS Registry Number |
9003-20-7 |
| EINECS |
202-500-6 |
| Molecular Structure |
|
| Density |
0.924g/cm3 |
| Boiling point |
80.2°C at 760 mmHg |
| Refractive index |
1.39 |
| Flash point |
6.7°C |
| Vapour Pressur |
86.3mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Poly(vinyl acetate) Material Safety Data Sheet
|
|
