ChemNet > CAS > 9003-42-3 Poly(ethyl methacrylate)
9003-42-3 Poly(ethyl methacrylate)
| product Name |
Poly(ethyl methacrylate) |
| CAS No |
9003-42-3 |
| Synonyms |
Ethyl Methacrylate Resin; ethyl 2-methylprop-2-enoate |
| Molecular Formula |
C6H10O2 |
| Molecular Weight |
114.1424 |
| InChI |
InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
| EINECS |
202-597-5 |
| Molecular Structure |
|
| Density |
0.906g/cm3 |
| Boiling point |
120.5°C at 760 mmHg |
| Refractive index |
1.409 |
| Flash point |
15.6°C |
| Vapour Pressur |
15.2mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
