9003-53-6 Poly(styrene)
product Name |
Poly(styrene) |
CAS No |
9003-53-6 |
Synonyms |
Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene |
Molecular Formula |
C8H8 |
Molecular Weight |
104.1491 |
InChI |
InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
Molecular Structure |
|
Density |
1.047 |
Boiling point |
212℃ |
Refractive index |
1.5916 |
Water solubility |
insoluble |
Hazard Symbols |
Xi:;
|
Risk Codes |
41:;
|
Safety Description |
S24/25:;
|
MSDS |
Material Safety Data Sheet
|
|